About 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine
2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine (PubChem CID 164662438) has the molecular formula C11H13F2N
and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine.
Molecular Properties
| Compound Name | 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine |
| PubChem CID | 164662438 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine |
| SMILES | NCCC1(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C11H13F2N/c12-9-2-1-8(7-10(9)13)11(3-4-11)5-6-14/h1-2,7H,3-6,14H2 |
| InChIKey | XEXJFNCOZRCLCY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine?
The IUPAC name of 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine (CID 164662438) is 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine.
What is the SMILES notation for 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine?
The canonical SMILES for 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine is NCCC1(c2ccc(F)c(F)c2)CC1.
What is the InChIKey of 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine?
The InChIKey is XEXJFNCOZRCLCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N/c12-9-2-1-8(7-10(9)13)11(3-4-11)5-6-14/h1-2,7H,3-6,14H2.
What are the key properties of 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine?
2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine has a molecular weight of 197.23 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,4-difluorophenyl)cyclopropyl]ethanamine is sourced from PubChem (CID 164662438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).