C11H11ClN2O2 — CID 164662694
2-chloro-4,6-dicyclopropyl-3-nitropyridine (PubChem CID 164662694) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 2-chloro-4,6-dicyclopropyl-3-nitropyridine.
| Compound Name | 2-chloro-4,6-dicyclopropyl-3-nitropyridine |
|---|---|
| PubChem CID | 164662694 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-chloro-4,6-dicyclopropyl-3-nitropyridine |
| SMILES | O=[N+]([O-])c1c(C2CC2)cc(C2CC2)nc1Cl |
| InChI | InChI=1S/C11H11ClN2O2/c12-11-10(14(15)16)8(6-1-2-6)5-9(13-11)7-3-4-7/h5-7H,1-4H2 |
| InChIKey | PIRYXBYVXQTLAV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|