C12H16N2O4Si — CID 164665475
ethyl 2-diazo-3,5-dioxo-7-trimethylsilylhept-6-ynoate (PubChem CID 164665475) has the molecular formula C12H16N2O4Si and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl 2-diazo-3,5-dioxo-7-trimethylsilylhept-6-ynoate.
| Compound Name | ethyl 2-diazo-3,5-dioxo-7-trimethylsilylhept-6-ynoate |
|---|---|
| PubChem CID | 164665475 |
| Molecular Formula | C12H16N2O4Si |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | ethyl 2-diazo-3,5-dioxo-7-trimethylsilylhept-6-ynoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(=O)CC(=O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H16N2O4Si/c1-5-18-12(17)11(14-13)10(16)8-9(15)6-7-19(2,3)4/h5,8H2,1-4H3 |
| InChIKey | TWGPQXBRNXYAKV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|