About lithium but-3-yn-2-olate
lithium but-3-yn-2-olate (PubChem CID 164665740) has the molecular formula C4H5LiO
and a molecular weight of 76.02 g/mol. Its IUPAC name is lithium but-3-yn-2-olate.
Molecular Properties
| Compound Name | lithium but-3-yn-2-olate |
| PubChem CID | 164665740 |
| Molecular Formula | C4H5LiO |
| Molecular Weight | 76.02 g/mol |
| Exact Mass | 76.05 |
| IUPAC Name | lithium but-3-yn-2-olate |
| SMILES | C#CC(C)[O-].[Li+] |
| InChI | InChI=1S/C4H5O.Li/c1-3-4(2)5;/h1,4H,2H3;/q-1;+1 |
| InChIKey | MHQXPUVFKIBGAD-UHFFFAOYSA-N |
| XLogP | -3.63 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.02 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze lithium but-3-yn-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium but-3-yn-2-olate?
The IUPAC name of lithium but-3-yn-2-olate (CID 164665740) is lithium but-3-yn-2-olate.
What is the SMILES notation for lithium but-3-yn-2-olate?
The canonical SMILES for lithium but-3-yn-2-olate is C#CC(C)[O-].[Li+].
What is the InChIKey of lithium but-3-yn-2-olate?
The InChIKey is MHQXPUVFKIBGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5O.Li/c1-3-4(2)5;/h1,4H,2H3;/q-1;+1.
What are the key properties of lithium but-3-yn-2-olate?
lithium but-3-yn-2-olate has a molecular weight of 76.02 g/mol, XLogP of -3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium but-3-yn-2-olate is sourced from PubChem (CID 164665740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).