About N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline
N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline (PubChem CID 164665998) has the molecular formula C27H25NO2S
and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline.
Molecular Properties
| Compound Name | N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline |
| PubChem CID | 164665998 |
| Molecular Formula | C27H25NO2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline |
| SMILES | O=S(=O)(CC(c1ccccc1)[C@@H](Nc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO2S/c29-31(30,25-19-11-4-12-20-25)21-26(22-13-5-1-6-14-22)27(23-15-7-2-8-16-23)28-24-17-9-3-10-18-24/h1-20,26-28H,21H2/t26?,27-/m0/s1 |
| InChIKey | ZIBPOQHUFCDPBA-GEVKEYJPSA-N |
| XLogP | 6.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline?
The IUPAC name of N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline (CID 164665998) is N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline.
What is the SMILES notation for N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline?
The canonical SMILES for N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline is O=S(=O)(CC(c1ccccc1)[C@@H](Nc1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline?
The InChIKey is ZIBPOQHUFCDPBA-GEVKEYJPSA-N. The full InChI is InChI=1S/C27H25NO2S/c29-31(30,25-19-11-4-12-20-25)21-26(22-13-5-1-6-14-22)27(23-15-7-2-8-16-23)28-24-17-9-3-10-18-24/h1-20,26-28H,21H2/t26?,27-/m0/s1.
What are the key properties of N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline?
N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline has a molecular weight of 427.57 g/mol, XLogP of 6.10, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline is sourced from PubChem (CID 164665998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).