C27H25NO2S — CID 164665998
N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline (PubChem CID 164665998) has the molecular formula C27H25NO2S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline.
| Compound Name | N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline |
|---|---|
| PubChem CID | 164665998 |
| Molecular Formula | C27H25NO2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[(1R)-3-(benzenesulfonyl)-1,2-diphenylpropyl]aniline |
| SMILES | O=S(=O)(CC(c1ccccc1)[C@@H](Nc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NO2S/c29-31(30,25-19-11-4-12-20-25)21-26(22-13-5-1-6-14-22)27(23-15-7-2-8-16-23)28-24-17-9-3-10-18-24/h1-20,26-28H,21H2/t26?,27-/m0/s1 |
| InChIKey | ZIBPOQHUFCDPBA-GEVKEYJPSA-N |
| XLogP | 6.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |