C26H18N2 — CID 164666039
4,9-diphenyl-3,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),8,12,14-heptaene (PubChem CID 164666039) has the molecular formula C26H18N2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4,9-diphenyl-3,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),8,12,14-heptaene.
| Compound Name | 4,9-diphenyl-3,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),8,12,14-heptaene |
|---|---|
| PubChem CID | 164666039 |
| Molecular Formula | C26H18N2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4,9-diphenyl-3,10-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),2(6),4,7(11),8,12,14-heptaene |
| SMILES | c1ccc(-c2cc3c4cc(-c5ccccc5)[nH]c4c4ccccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C26H18N2/c1-3-9-17(10-4-1)23-15-21-22-16-24(18-11-5-2-6-12-18)28-26(22)20-14-8-7-13-19(20)25(21)27-23/h1-16,27-28H |
| InChIKey | LLHXHIWTDQMZTP-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |