C18H13NO2 — CID 14387111
2-phenyl-1H-benzo[g]indole-5,9-diol (PubChem CID 14387111) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-phenyl-1H-benzo[g]indole-5,9-diol.
| Compound Name | 2-phenyl-1H-benzo[g]indole-5,9-diol |
|---|---|
| PubChem CID | 14387111 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-phenyl-1H-benzo[g]indole-5,9-diol |
| SMILES | Oc1cc2cc(-c3ccccc3)[nH]c2c2c(O)cccc12 |
| InChI | InChI=1S/C18H13NO2/c20-15-8-4-7-13-16(21)10-12-9-14(19-18(12)17(13)15)11-5-2-1-3-6-11/h1-10,19-21H |
| InChIKey | AHDWZFTUDTVKTJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |