C20H17NO2 — CID 14387106
5,9-dimethoxy-2-phenyl-1H-benzo[g]indole (PubChem CID 14387106) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is 5,9-dimethoxy-2-phenyl-1H-benzo[g]indole.
| Compound Name | 5,9-dimethoxy-2-phenyl-1H-benzo[g]indole |
|---|---|
| PubChem CID | 14387106 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5,9-dimethoxy-2-phenyl-1H-benzo[g]indole |
| SMILES | COc1cc2cc(-c3ccccc3)[nH]c2c2c(OC)cccc12 |
| InChI | InChI=1S/C20H17NO2/c1-22-17-10-6-9-15-18(23-2)12-14-11-16(21-20(14)19(15)17)13-7-4-3-5-8-13/h3-12,21H,1-2H3 |
| InChIKey | BSWVFQWUXRWCGZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |