C12H4F6N2 — CID 164666836
2,4-bis(trifluoromethyl)quinoline-6-carbonitrile (PubChem CID 164666836) has the molecular formula C12H4F6N2 and a molecular weight of 290.17 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)quinoline-6-carbonitrile.
| Compound Name | 2,4-bis(trifluoromethyl)quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 164666836 |
| Molecular Formula | C12H4F6N2 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2,4-bis(trifluoromethyl)quinoline-6-carbonitrile |
| SMILES | N#Cc1ccc2nc(C(F)(F)F)cc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C12H4F6N2/c13-11(14,15)8-4-10(12(16,17)18)20-9-2-1-6(5-19)3-7(8)9/h1-4H |
| InChIKey | FWKFJXYCFRORSJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |