C21H19F6O4+ — CID 164667865
1-(2,4-dimethoxyphenyl)-5,7-dimethoxy-1,3-bis(trifluoromethyl)-2H-inden-3-ylium (PubChem CID 164667865) has the molecular formula C21H19F6O4+ and a molecular weight of 449.37 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-5,7-dimethoxy-1,3-bis(trifluoromethyl)-2H-inden-3-ylium.
| Compound Name | 1-(2,4-dimethoxyphenyl)-5,7-dimethoxy-1,3-bis(trifluoromethyl)-2H-inden-3-ylium |
|---|---|
| PubChem CID | 164667865 |
| Molecular Formula | C21H19F6O4+ |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-5,7-dimethoxy-1,3-bis(trifluoromethyl)-2H-inden-3-ylium |
| SMILES | COc1ccc(C2(C(F)(F)F)C[C+](C(F)(F)F)c3cc(OC)cc(OC)c32)c(OC)c1 |
| InChI | InChI=1S/C21H19F6O4/c1-28-11-5-6-14(16(8-11)30-3)19(21(25,26)27)10-15(20(22,23)24)13-7-12(29-2)9-17(31-4)18(13)19/h5-9H,10H2,1-4H3/q+1 |
| InChIKey | PUZXNEJVEVXXPM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|