C21H13NOS — CID 164667883
3-phenyl-1-thiophen-2-yl-[1]benzofuro[2,3-c]pyridine (PubChem CID 164667883) has the molecular formula C21H13NOS and a molecular weight of 327.41 g/mol. Its IUPAC name is 3-phenyl-1-thiophen-2-yl-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 3-phenyl-1-thiophen-2-yl-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 164667883 |
| Molecular Formula | C21H13NOS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-phenyl-1-thiophen-2-yl-[1]benzofuro[2,3-c]pyridine |
| SMILES | c1ccc(-c2cc3c(oc4ccccc43)c(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C21H13NOS/c1-2-7-14(8-3-1)17-13-16-15-9-4-5-10-18(15)23-21(16)20(22-17)19-11-6-12-24-19/h1-13H |
| InChIKey | SSCHOWHXPCTXGM-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |