C30H28F3NO2 — CID 164667926
(3S,4S)-3-benzoyl-1-tert-butyl-4-phenyl-3-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]azetidin-2-one (PubChem CID 164667926) has the molecular formula C30H28F3NO2 and a molecular weight of 491.55 g/mol. Its IUPAC name is (3S,4S)-3-benzoyl-1-tert-butyl-4-phenyl-3-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]azetidin-2-one.
| Compound Name | (3S,4S)-3-benzoyl-1-tert-butyl-4-phenyl-3-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]azetidin-2-one |
|---|---|
| PubChem CID | 164667926 |
| Molecular Formula | C30H28F3NO2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | (3S,4S)-3-benzoyl-1-tert-butyl-4-phenyl-3-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]azetidin-2-one |
| SMILES | CC(C)(C)N1C(=O)[C@](C/C=C/c2ccc(C(F)(F)F)cc2)(C(=O)c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H28F3NO2/c1-28(2,3)34-25(22-12-6-4-7-13-22)29(27(34)36,26(35)23-14-8-5-9-15-23)20-10-11-21-16-18-24(19-17-21)30(31,32)33/h4-19,25H,20H2,1-3H3/b11-10+/t25-,29-/m0/s1 |
| InChIKey | ZNIGARIVAYNDHA-BGMUZVAVSA-N |
| XLogP | 7.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|