C22H17F3O3 — CID 102130653
methyl 2-oxo-1-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]naphthalene-1-carboxylate (PubChem CID 102130653) has the molecular formula C22H17F3O3 and a molecular weight of 386.37 g/mol. Its IUPAC name is methyl 2-oxo-1-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]naphthalene-1-carboxylate.
| Compound Name | methyl 2-oxo-1-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 102130653 |
| Molecular Formula | C22H17F3O3 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | methyl 2-oxo-1-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enyl]naphthalene-1-carboxylate |
| SMILES | COC(=O)C1(C/C=C/c2ccc(C(F)(F)F)cc2)C(=O)C=Cc2ccccc21 |
| InChI | InChI=1S/C22H17F3O3/c1-28-20(27)21(18-7-3-2-6-16(18)10-13-19(21)26)14-4-5-15-8-11-17(12-9-15)22(23,24)25/h2-13H,14H2,1H3/b5-4+ |
| InChIKey | BEYXLQHKXSJVJZ-SNAWJCMRSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|