C17H21NO3 — CID 164667963
(2S,4aR,5S)-2-ethyl-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one (PubChem CID 164667963) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S,4aR,5S)-2-ethyl-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one.
| Compound Name | (2S,4aR,5S)-2-ethyl-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one |
|---|---|
| PubChem CID | 164667963 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2S,4aR,5S)-2-ethyl-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one |
| SMILES | CC[C@H]1C=C[C@@H]2[C@@H](OCc3ccccc3)CCC(=O)N2O1 |
| InChI | InChI=1S/C17H21NO3/c1-2-14-8-9-15-16(10-11-17(19)18(15)21-14)20-12-13-6-4-3-5-7-13/h3-9,14-16H,2,10-12H2,1H3/t14-,15+,16-/m0/s1 |
| InChIKey | PLKZCTOITIGJTD-XHSDSOJGSA-N |
| XLogP | 2.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|