C33H30N10 — CID 164669286
1,4,7-tris(1-phenyltriazol-4-yl)-10-azatricyclo[5.2.1.04,10]decane (PubChem CID 164669286) has the molecular formula C33H30N10 and a molecular weight of 566.67 g/mol. Its IUPAC name is 1,4,7-tris(1-phenyltriazol-4-yl)-10-azatricyclo[5.2.1.04,10]decane.
| Compound Name | 1,4,7-tris(1-phenyltriazol-4-yl)-10-azatricyclo[5.2.1.04,10]decane |
|---|---|
| PubChem CID | 164669286 |
| Molecular Formula | C33H30N10 |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 1,4,7-tris(1-phenyltriazol-4-yl)-10-azatricyclo[5.2.1.04,10]decane |
| SMILES | c1ccc(-n2cc(C34CCC5(c6cn(-c7ccccc7)nn6)CCC(c6cn(-c7ccccc7)nn6)(CC3)N45)nn2)cc1 |
| InChI | InChI=1S/C33H30N10/c1-4-10-25(11-5-1)40-22-28(34-37-40)31-16-18-32(29-23-41(38-35-29)26-12-6-2-7-13-26)20-21-33(19-17-31,43(31)32)30-24-42(39-36-30)27-14-8-3-9-15-27/h1-15,22-24H,16-21H2 |
| InChIKey | WLQMQJPNMHAWJT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |