C6H5N5O2 — CID 164669430
5-nitro-1H-pyrazolo[3,4-b]pyridin-4-amine (PubChem CID 164669430) has the molecular formula C6H5N5O2 and a molecular weight of 179.14 g/mol. Its IUPAC name is 5-nitro-1H-pyrazolo[3,4-b]pyridin-4-amine.
| Compound Name | 5-nitro-1H-pyrazolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 164669430 |
| Molecular Formula | C6H5N5O2 |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 5-nitro-1H-pyrazolo[3,4-b]pyridin-4-amine |
| SMILES | Nc1c([N+](=O)[O-])cnc2[nH]ncc12 |
| InChI | InChI=1S/C6H5N5O2/c7-5-3-1-9-10-6(3)8-2-4(5)11(12)13/h1-2H,(H3,7,8,9,10) |
| InChIKey | DTNKBOKTEKRWFK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|