C11H12F2O3S — CID 164670252
ethyl 2-benzylsulfinyl-2,2-difluoroacetate (PubChem CID 164670252) has the molecular formula C11H12F2O3S and a molecular weight of 262.28 g/mol. Its IUPAC name is ethyl 2-benzylsulfinyl-2,2-difluoroacetate.
| Compound Name | ethyl 2-benzylsulfinyl-2,2-difluoroacetate |
|---|---|
| PubChem CID | 164670252 |
| Molecular Formula | C11H12F2O3S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | ethyl 2-benzylsulfinyl-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)S(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H12F2O3S/c1-2-16-10(14)11(12,13)17(15)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | RKOVECLPZFOMJV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |