C16H10F6N2O — CID 164670442
1-(4-methoxyphenyl)-2,5-bis(trifluoromethyl)benzimidazole (PubChem CID 164670442) has the molecular formula C16H10F6N2O and a molecular weight of 360.26 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,5-bis(trifluoromethyl)benzimidazole.
| Compound Name | 1-(4-methoxyphenyl)-2,5-bis(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 164670442 |
| Molecular Formula | C16H10F6N2O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,5-bis(trifluoromethyl)benzimidazole |
| SMILES | COc1ccc(-n2c(C(F)(F)F)nc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C16H10F6N2O/c1-25-11-5-3-10(4-6-11)24-13-7-2-9(15(17,18)19)8-12(13)23-14(24)16(20,21)22/h2-8H,1H3 |
| InChIKey | SNZWJOQATSMLMX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |