About acetic acid;copper(1+);piperidin-1-ide
acetic acid;copper(1+);piperidin-1-ide (PubChem CID 164670473) has the molecular formula C7H14CuNO2
and a molecular weight of 207.74 g/mol. Its IUPAC name is acetic acid;copper(1+);piperidin-1-ide.
Molecular Properties
| Compound Name | acetic acid;copper(1+);piperidin-1-ide |
| PubChem CID | 164670473 |
| Molecular Formula | C7H14CuNO2 |
| Molecular Weight | 207.74 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | acetic acid;copper(1+);piperidin-1-ide |
| SMILES | C1CC[N-]CC1.CC(=O)O.[Cu+] |
| InChI | InChI=1S/C5H10N.C2H4O2.Cu/c1-2-4-6-5-3-1;1-2(3)4;/h1-5H2;1H3,(H,3,4);/q-1;;+1 |
| InChIKey | QRDOUMOUNDYLPU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.74 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;copper(1+);piperidin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;copper(1+);piperidin-1-ide?
The IUPAC name of acetic acid;copper(1+);piperidin-1-ide (CID 164670473) is acetic acid;copper(1+);piperidin-1-ide.
What is the SMILES notation for acetic acid;copper(1+);piperidin-1-ide?
The canonical SMILES for acetic acid;copper(1+);piperidin-1-ide is C1CC[N-]CC1.CC(=O)O.[Cu+].
What is the InChIKey of acetic acid;copper(1+);piperidin-1-ide?
The InChIKey is QRDOUMOUNDYLPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N.C2H4O2.Cu/c1-2-4-6-5-3-1;1-2(3)4;/h1-5H2;1H3,(H,3,4);/q-1;;+1.
What are the key properties of acetic acid;copper(1+);piperidin-1-ide?
acetic acid;copper(1+);piperidin-1-ide has a molecular weight of 207.74 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;copper(1+);piperidin-1-ide is sourced from PubChem (CID 164670473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).