About molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide
molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide (PubChem CID 151025303) has the molecular formula C9H18MoN2
and a molecular weight of 250.20 g/mol. Its IUPAC name is molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide.
Molecular Properties
| Compound Name | molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide |
| PubChem CID | 151025303 |
| Molecular Formula | C9H18MoN2 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide |
| SMILES | C1CC[N-]C1.C1CC[N-]CC1.[Mo+2] |
| InChI | InChI=1S/C5H10N.C4H8N.Mo/c1-2-4-6-5-3-1;1-2-4-5-3-1;/h1-5H2;1-4H2;/q2*-1;+2 |
| InChIKey | LYXPWJMLUWYJFW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide?
The IUPAC name of molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide (CID 151025303) is molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide.
What is the SMILES notation for molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide?
The canonical SMILES for molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide is C1CC[N-]C1.C1CC[N-]CC1.[Mo+2].
What is the InChIKey of molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide?
The InChIKey is LYXPWJMLUWYJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N.C4H8N.Mo/c1-2-4-6-5-3-1;1-2-4-5-3-1;/h1-5H2;1-4H2;/q2*-1;+2.
What are the key properties of molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide?
molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide has a molecular weight of 250.20 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for molybdenum(2+);piperidin-1-ide;pyrrolidin-1-ide is sourced from PubChem (CID 151025303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).