About bis(piperidin-1-ide);trichlororhodium
bis(piperidin-1-ide);trichlororhodium (PubChem CID 54604493) has the molecular formula C10H20Cl3N2Rh-2
and a molecular weight of 377.55 g/mol. Its IUPAC name is bis(piperidin-1-ide);trichlororhodium.
Molecular Properties
| Compound Name | bis(piperidin-1-ide);trichlororhodium |
| PubChem CID | 54604493 |
| Molecular Formula | C10H20Cl3N2Rh-2 |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | bis(piperidin-1-ide);trichlororhodium |
| SMILES | C1CC[N-]CC1.C1CC[N-]CC1.Cl[Rh](Cl)Cl |
| InChI | InChI=1S/2C5H10N.3ClH.Rh/c2*1-2-4-6-5-3-1;;;;/h2*1-5H2;3*1H;/q2*-1;;;;+3/p-3 |
| InChIKey | DIRGQXRUKYJKAU-UHFFFAOYSA-K |
| XLogP | 5.15 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(piperidin-1-ide);trichlororhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(piperidin-1-ide);trichlororhodium?
The IUPAC name of bis(piperidin-1-ide);trichlororhodium (CID 54604493) is bis(piperidin-1-ide);trichlororhodium.
What is the SMILES notation for bis(piperidin-1-ide);trichlororhodium?
The canonical SMILES for bis(piperidin-1-ide);trichlororhodium is C1CC[N-]CC1.C1CC[N-]CC1.Cl[Rh](Cl)Cl.
What is the InChIKey of bis(piperidin-1-ide);trichlororhodium?
The InChIKey is DIRGQXRUKYJKAU-UHFFFAOYSA-K. The full InChI is InChI=1S/2C5H10N.3ClH.Rh/c2*1-2-4-6-5-3-1;;;;/h2*1-5H2;3*1H;/q2*-1;;;;+3/p-3.
What are the key properties of bis(piperidin-1-ide);trichlororhodium?
bis(piperidin-1-ide);trichlororhodium has a molecular weight of 377.55 g/mol, XLogP of 5.15, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(piperidin-1-ide);trichlororhodium is sourced from PubChem (CID 54604493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).