C11H22N4Ni-2 — CID 50896977
nickel(2+);1,4,8,11-tetrazanidacyclopentadecane (PubChem CID 50896977) has the molecular formula C11H22N4Ni-2 and a molecular weight of 269.02 g/mol. Its IUPAC name is nickel(2+);1,4,8,11-tetrazanidacyclopentadecane.
| Compound Name | nickel(2+);1,4,8,11-tetrazanidacyclopentadecane |
|---|---|
| PubChem CID | 50896977 |
| Molecular Formula | C11H22N4Ni-2 |
| Molecular Weight | 269.02 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | nickel(2+);1,4,8,11-tetrazanidacyclopentadecane |
| SMILES | C1CC[N-]CC[N-]CCC[N-]CC[N-]C1.[Ni+2] |
| InChI | InChI=1S/C11H22N4.Ni/c1-2-5-13-9-11-15-7-3-6-14-10-8-12-4-1;/h1-11H2;/q-4;+2 |
| InChIKey | DWHNJGXUBSJYBG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.02 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |