C22H42N8Ni2-4 — CID 50896978
bis(nickel(2+));6-[2-(1,4,8,11-tetrazanidacyclotetradec-6-yl)ethyl]-1,4,8,11-tetrazanidacyclotetradecane (PubChem CID 50896978) has the molecular formula C22H42N8Ni2-4 and a molecular weight of 536.02 g/mol. Its IUPAC name is bis(nickel(2+));6-[2-(1,4,8,11-tetrazanidacyclotetradec-6-yl)ethyl]-1,4,8,11-tetrazanidacyclotetradecane.
| Compound Name | bis(nickel(2+));6-[2-(1,4,8,11-tetrazanidacyclotetradec-6-yl)ethyl]-1,4,8,11-tetrazanidacyclotetradecane |
|---|---|
| PubChem CID | 50896978 |
| Molecular Formula | C22H42N8Ni2-4 |
| Molecular Weight | 536.02 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | bis(nickel(2+));6-[2-(1,4,8,11-tetrazanidacyclotetradec-6-yl)ethyl]-1,4,8,11-tetrazanidacyclotetradecane |
| SMILES | C1C[N-]CC[N-]CC(CCC2C[N-]CC[N-]CCC[N-]CC[N-]C2)C[N-]CC[N-]C1.[Ni+2].[Ni+2] |
| InChI | InChI=1S/C22H42N8.2Ni/c1-5-23-9-13-27-17-21(18-28-14-10-24-6-1)3-4-22-19-29-15-11-25-7-2-8-26-12-16-30-20-22;;/h21-22H,1-20H2;;/q-8;2*+2 |
| InChIKey | WHULXOOMUVPRNL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 112.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.02 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |