About difluorozirconium(2+);bis(piperidin-1-ide)
difluorozirconium(2+);bis(piperidin-1-ide) (PubChem CID 173243334) has the molecular formula C10H20F2N2Zr
and a molecular weight of 297.50 g/mol. Its IUPAC name is difluorozirconium(2+);bis(piperidin-1-ide).
Molecular Properties
| Compound Name | difluorozirconium(2+);bis(piperidin-1-ide) |
| PubChem CID | 173243334 |
| Molecular Formula | C10H20F2N2Zr |
| Molecular Weight | 297.50 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | difluorozirconium(2+);bis(piperidin-1-ide) |
| SMILES | C1CC[N-]CC1.C1CC[N-]CC1.F[Zr+2]F |
| InChI | InChI=1S/2C5H10N.2FH.Zr/c2*1-2-4-6-5-3-1;;;/h2*1-5H2;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | BMNBLOVZRMRKJY-UHFFFAOYSA-L |
| XLogP | 3.93 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze difluorozirconium(2+);bis(piperidin-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluorozirconium(2+);bis(piperidin-1-ide)?
The IUPAC name of difluorozirconium(2+);bis(piperidin-1-ide) (CID 173243334) is difluorozirconium(2+);bis(piperidin-1-ide).
What is the SMILES notation for difluorozirconium(2+);bis(piperidin-1-ide)?
The canonical SMILES for difluorozirconium(2+);bis(piperidin-1-ide) is C1CC[N-]CC1.C1CC[N-]CC1.F[Zr+2]F.
What is the InChIKey of difluorozirconium(2+);bis(piperidin-1-ide)?
The InChIKey is BMNBLOVZRMRKJY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H10N.2FH.Zr/c2*1-2-4-6-5-3-1;;;/h2*1-5H2;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of difluorozirconium(2+);bis(piperidin-1-ide)?
difluorozirconium(2+);bis(piperidin-1-ide) has a molecular weight of 297.50 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for difluorozirconium(2+);bis(piperidin-1-ide) is sourced from PubChem (CID 173243334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).