C8H9NO3 — CID 164670478
(1R,5R)-6-(hydroxymethyl)-3-methyl-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione (PubChem CID 164670478) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is (1R,5R)-6-(hydroxymethyl)-3-methyl-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione.
| Compound Name | (1R,5R)-6-(hydroxymethyl)-3-methyl-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione |
|---|---|
| PubChem CID | 164670478 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | (1R,5R)-6-(hydroxymethyl)-3-methyl-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione |
| SMILES | CN1C(=O)[C@H]2C(CO)=C[C@H]2C1=O |
| InChI | InChI=1S/C8H9NO3/c1-9-7(11)5-2-4(3-10)6(5)8(9)12/h2,5-6,10H,3H2,1H3/t5-,6+/m1/s1 |
| InChIKey | NDKUOJAZTGMLTO-RITPCOANSA-N |
| XLogP | -0.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|