C7H7NO3 — CID 93497495
(1R,5R)-6-(hydroxymethyl)-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione (PubChem CID 93497495) has the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. Its IUPAC name is (1R,5R)-6-(hydroxymethyl)-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione.
| Compound Name | (1R,5R)-6-(hydroxymethyl)-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione |
|---|---|
| PubChem CID | 93497495 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | (1R,5R)-6-(hydroxymethyl)-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione |
| SMILES | O=C1NC(=O)[C@@H]2C=C(CO)[C@H]12 |
| InChI | InChI=1S/C7H7NO3/c9-2-3-1-4-5(3)7(11)8-6(4)10/h1,4-5,9H,2H2,(H,8,10,11)/t4-,5+/m1/s1 |
| InChIKey | VWYPPACEJLSUBL-UHNVWZDZSA-N |
| XLogP | -1.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|