C8H9NO3 — CID 130123507
6-(2-hydroxyethyl)-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione (PubChem CID 130123507) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 6-(2-hydroxyethyl)-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione.
| Compound Name | 6-(2-hydroxyethyl)-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione |
|---|---|
| PubChem CID | 130123507 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 6-(2-hydroxyethyl)-3-azabicyclo[3.2.0]hept-6-ene-2,4-dione |
| SMILES | O=C1NC(=O)C2C(CCO)=CC12 |
| InChI | InChI=1S/C8H9NO3/c10-2-1-4-3-5-6(4)8(12)9-7(5)11/h3,5-6,10H,1-2H2,(H,9,11,12) |
| InChIKey | UQEXXDOJBIIRAP-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|