C11H15NO3 — CID 141055001
7a-(3-hydroxypropyl)-4,5-dihydro-3aH-isoindole-1,3-dione (PubChem CID 141055001) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 7a-(3-hydroxypropyl)-4,5-dihydro-3aH-isoindole-1,3-dione.
| Compound Name | 7a-(3-hydroxypropyl)-4,5-dihydro-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 141055001 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 7a-(3-hydroxypropyl)-4,5-dihydro-3aH-isoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2(CCCO)C=CCCC12 |
| InChI | InChI=1S/C11H15NO3/c13-7-3-6-11-5-2-1-4-8(11)9(14)12-10(11)15/h2,5,8,13H,1,3-4,6-7H2,(H,12,14,15) |
| InChIKey | NXOCCZUXUMULIM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|