C23H28N2O6 — CID 67646685
7a-(4-hydroxybutyl)-3aH-isoindole-1,3-dione;7a-(3-hydroxypropyl)-3aH-isoindole-1,3-dione (PubChem CID 67646685) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is 7a-(4-hydroxybutyl)-3aH-isoindole-1,3-dione;7a-(3-hydroxypropyl)-3aH-isoindole-1,3-dione.
| Compound Name | 7a-(4-hydroxybutyl)-3aH-isoindole-1,3-dione;7a-(3-hydroxypropyl)-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 67646685 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 7a-(4-hydroxybutyl)-3aH-isoindole-1,3-dione;7a-(3-hydroxypropyl)-3aH-isoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2(CCCCO)C=CC=CC12.O=C1NC(=O)C2(CCCO)C=CC=CC12 |
| InChI | InChI=1S/C12H15NO3.C11H13NO3/c14-8-4-3-7-12-6-2-1-5-9(12)10(15)13-11(12)16;13-7-3-6-11-5-2-1-4-8(11)9(14)12-10(11)15/h1-2,5-6,9,14H,3-4,7-8H2,(H,13,15,16);1-2,4-5,8,13H,3,6-7H2,(H,12,14,15) |
| InChIKey | OHFJAXGQHGXEGB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|