C15H21NO3 — CID 21190285
7a-(5-hydroxy-3,3-dimethylpentyl)-3aH-isoindole-1,3-dione (PubChem CID 21190285) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 7a-(5-hydroxy-3,3-dimethylpentyl)-3aH-isoindole-1,3-dione.
| Compound Name | 7a-(5-hydroxy-3,3-dimethylpentyl)-3aH-isoindole-1,3-dione |
|---|---|
| PubChem CID | 21190285 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 7a-(5-hydroxy-3,3-dimethylpentyl)-3aH-isoindole-1,3-dione |
| SMILES | CC(C)(CCO)CCC12C=CC=CC1C(=O)NC2=O |
| InChI | InChI=1S/C15H21NO3/c1-14(2,9-10-17)7-8-15-6-4-3-5-11(15)12(18)16-13(15)19/h3-6,11,17H,7-10H2,1-2H3,(H,16,18,19) |
| InChIKey | WMQCMHCMDAQLKJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|