C10H13NO3 — CID 54590670
(3aR,4R,7S,7aS)-4-(hydroxymethyl)-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 54590670) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-4-(hydroxymethyl)-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4R,7S,7aS)-4-(hydroxymethyl)-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 54590670 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (3aR,4R,7S,7aS)-4-(hydroxymethyl)-7-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C[C@H]1C=C[C@@H](CO)[C@H]2C(=O)NC(=O)[C@H]21 |
| InChI | InChI=1S/C10H13NO3/c1-5-2-3-6(4-12)8-7(5)9(13)11-10(8)14/h2-3,5-8,12H,4H2,1H3,(H,11,13,14)/t5-,6-,7-,8+/m0/s1 |
| InChIKey | PQDSDAIHWMLCMS-DKXJUACHSA-N |
| XLogP | -0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|