About 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione
7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione (PubChem CID 19079239) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione.
Molecular Properties
| Compound Name | 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
| PubChem CID | 19079239 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2(CO)CC=CCC12 |
| InChI | InChI=1S/C9H11NO3/c11-5-9-4-2-1-3-6(9)7(12)10-8(9)13/h1-2,6,11H,3-5H2,(H,10,12,13) |
| InChIKey | BBWIQWUUQXUEGG-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione?
The IUPAC name of 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione (CID 19079239) is 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione.
What is the SMILES notation for 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione?
The canonical SMILES for 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione is O=C1NC(=O)C2(CO)CC=CCC12.
What is the InChIKey of 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione?
The InChIKey is BBWIQWUUQXUEGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c11-5-9-4-2-1-3-6(9)7(12)10-8(9)13/h1-2,6,11H,3-5H2,(H,10,12,13).
What are the key properties of 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione?
7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione has a molecular weight of 181.19 g/mol, XLogP of -0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7a-(hydroxymethyl)-4,7-dihydro-3aH-isoindole-1,3-dione is sourced from PubChem (CID 19079239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).