C33H25ClN2O — CID 164671440
(4-chlorophenyl)-[1-[2-(1H-indol-3-yl)ethyl]-2,4-diphenylpyrrol-3-yl]methanone (PubChem CID 164671440) has the molecular formula C33H25ClN2O and a molecular weight of 501.03 g/mol. Its IUPAC name is (4-chlorophenyl)-[1-[2-(1H-indol-3-yl)ethyl]-2,4-diphenylpyrrol-3-yl]methanone.
| Compound Name | (4-chlorophenyl)-[1-[2-(1H-indol-3-yl)ethyl]-2,4-diphenylpyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 164671440 |
| Molecular Formula | C33H25ClN2O |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (4-chlorophenyl)-[1-[2-(1H-indol-3-yl)ethyl]-2,4-diphenylpyrrol-3-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1c(-c2ccccc2)cn(CCc2c[nH]c3ccccc23)c1-c1ccccc1 |
| InChI | InChI=1S/C33H25ClN2O/c34-27-17-15-25(16-18-27)33(37)31-29(23-9-3-1-4-10-23)22-36(32(31)24-11-5-2-6-12-24)20-19-26-21-35-30-14-8-7-13-28(26)30/h1-18,21-22,35H,19-20H2 |
| InChIKey | JNBYXSPFZIBIJA-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |