C12H14BNO6S — CID 164671676
(2R)-2-[(4-boronophenyl)methylideneamino]-3-(carboxymethylsulfanyl)propanoic acid (PubChem CID 164671676) has the molecular formula C12H14BNO6S and a molecular weight of 311.12 g/mol. Its IUPAC name is (2R)-2-[(4-boronophenyl)methylideneamino]-3-(carboxymethylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-[(4-boronophenyl)methylideneamino]-3-(carboxymethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 164671676 |
| Molecular Formula | C12H14BNO6S |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (2R)-2-[(4-boronophenyl)methylideneamino]-3-(carboxymethylsulfanyl)propanoic acid |
| SMILES | O=C(O)CSC[C@H](/N=C/c1ccc(B(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C12H14BNO6S/c15-11(16)7-21-6-10(12(17)18)14-5-8-1-3-9(4-2-8)13(19)20/h1-5,10,19-20H,6-7H2,(H,15,16)(H,17,18)/b14-5+/t10-/m0/s1 |
| InChIKey | VDMGLGLQKYJWSP-ZFGNZVLRSA-N |
| XLogP | -0.94 |
| TPSA | 127.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|