C22H32N2O6 — CID 164671778
1-O-tert-butyl 5-O-methyl (2S)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]-2H-pyridine-1,5-dicarboxylate (PubChem CID 164671778) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl (2S)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]-2H-pyridine-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-methyl (2S)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]-2H-pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 164671778 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl (2S)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-3,6-dihydro-2H-pyridin-4-yl]-2H-pyridine-1,5-dicarboxylate |
| SMILES | COC(=O)C1=CN(C(=O)OC(C)(C)C)[C@H](C2=CCN(C(=O)OC(C)(C)C)CC2)C=C1 |
| InChI | InChI=1S/C22H32N2O6/c1-21(2,3)29-19(26)23-12-10-15(11-13-23)17-9-8-16(18(25)28-7)14-24(17)20(27)30-22(4,5)6/h8-10,14,17H,11-13H2,1-7H3/t17-/m0/s1 |
| InChIKey | BKELMFBKIOOSKO-KRWDZBQOSA-N |
| XLogP | 3.79 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|