C38H68N4Si2 — CID 164672685
trans-(1S,2S)-1-N,2-N-dimethyl-1-N,2-N-bis[[5-tri(propan-2-yl)silyl-2-pyridinyl]methyl]cyclohexane-1,2-diamine (PubChem CID 164672685) has the molecular formula C38H68N4Si2 and a molecular weight of 637.16 g/mol. Its IUPAC name is trans-(1S,2S)-1-N,2-N-dimethyl-1-N,2-N-bis[[5-tri(propan-2-yl)silyl-2-pyridinyl]methyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-1-N,2-N-dimethyl-1-N,2-N-bis[[5-tri(propan-2-yl)silyl-2-pyridinyl]methyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 164672685 |
| Molecular Formula | C38H68N4Si2 |
| Molecular Weight | 637.16 g/mol |
| Exact Mass | 636.50 |
| IUPAC Name | trans-(1S,2S)-1-N,2-N-dimethyl-1-N,2-N-bis[[5-tri(propan-2-yl)silyl-2-pyridinyl]methyl]cyclohexane-1,2-diamine |
| SMILES | CC(C)[Si](c1ccc(CN(C)[C@H]2CCCC[C@@H]2N(C)Cc2ccc([Si](C(C)C)(C(C)C)C(C)C)cn2)nc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H68N4Si2/c1-27(2)43(28(3)4,29(5)6)35-21-19-33(39-23-35)25-41(13)37-17-15-16-18-38(37)42(14)26-34-20-22-36(24-40-34)44(30(7)8,31(9)10)32(11)12/h19-24,27-32,37-38H,15-18,25-26H2,1-14H3/t37-,38-/m0/s1 |
| InChIKey | BNEWEWPEYWJAPZ-UWXQCODUSA-N |
| XLogP | 9.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.16 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|