C20H37N3O2 — CID 164673220
tert-butyl 4-[(2S)-4-(methylamino)-2-piperidin-1-ylbutyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 164673220) has the molecular formula C20H37N3O2 and a molecular weight of 351.54 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-4-(methylamino)-2-piperidin-1-ylbutyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-4-(methylamino)-2-piperidin-1-ylbutyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 164673220 |
| Molecular Formula | C20H37N3O2 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | tert-butyl 4-[(2S)-4-(methylamino)-2-piperidin-1-ylbutyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CNCC[C@H](CC1=CCN(C(=O)OC(C)(C)C)CC1)N1CCCCC1 |
| InChI | InChI=1S/C20H37N3O2/c1-20(2,3)25-19(24)23-14-9-17(10-15-23)16-18(8-11-21-4)22-12-6-5-7-13-22/h9,18,21H,5-8,10-16H2,1-4H3/t18-/m1/s1 |
| InChIKey | CKJQKNAWTBQNBZ-GOSISDBHSA-N |
| XLogP | 3.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|