C16H24N2O2Y-2 — CID 58315712
azanide;tert-butyl 2-phenylpiperidine-1-carboxylate;yttrium (PubChem CID 58315712) has the molecular formula C16H24N2O2Y-2 and a molecular weight of 365.29 g/mol. Its IUPAC name is azanide;tert-butyl 2-phenylpiperidine-1-carboxylate;yttrium.
| Compound Name | azanide;tert-butyl 2-phenylpiperidine-1-carboxylate;yttrium |
|---|---|
| PubChem CID | 58315712 |
| Molecular Formula | C16H24N2O2Y-2 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | azanide;tert-butyl 2-phenylpiperidine-1-carboxylate;yttrium |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1c1cc[c-]cc1.[NH2-].[Y] |
| InChI | InChI=1S/C16H22NO2.H2N.Y/c1-16(2,3)19-15(18)17-12-8-7-11-14(17)13-9-5-4-6-10-13;;/h5-6,9-10,14H,7-8,11-12H2,1-3H3;1H2;/q2*-1; |
| InChIKey | JJATWIBVLQQROA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|