C17H33BO2 — CID 164673329
4,4,5,5-tetramethyl-2-[(E)-5,7,7-trimethyloct-2-enyl]-1,3,2-dioxaborolane (PubChem CID 164673329) has the molecular formula C17H33BO2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-5,7,7-trimethyloct-2-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-5,7,7-trimethyloct-2-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164673329 |
| Molecular Formula | C17H33BO2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-5,7,7-trimethyloct-2-enyl]-1,3,2-dioxaborolane |
| SMILES | CC(C/C=C/CB1OC(C)(C)C(C)(C)O1)CC(C)(C)C |
| InChI | InChI=1S/C17H33BO2/c1-14(13-15(2,3)4)11-9-10-12-18-19-16(5,6)17(7,8)20-18/h9-10,14H,11-13H2,1-8H3/b10-9+ |
| InChIKey | HCAZYHNPSVMGHW-MDZDMXLPSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|