C34H59BO2 — CID 59052621
2-[(6E,10S,11E,13R,16E)-2,6,10,13,17,21-hexamethyldocosa-2,6,11,16,20-pentaen-10-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 59052621) has the molecular formula C34H59BO2 and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-[(6E,10S,11E,13R,16E)-2,6,10,13,17,21-hexamethyldocosa-2,6,11,16,20-pentaen-10-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(6E,10S,11E,13R,16E)-2,6,10,13,17,21-hexamethyldocosa-2,6,11,16,20-pentaen-10-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 59052621 |
| Molecular Formula | C34H59BO2 |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.46 |
| IUPAC Name | 2-[(6E,10S,11E,13R,16E)-2,6,10,13,17,21-hexamethyldocosa-2,6,11,16,20-pentaen-10-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@H](C)/C=C/[C@@](C)(CC/C=C(\C)CCC=C(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C34H59BO2/c1-27(2)17-13-19-29(5)21-15-22-31(7)24-26-34(12,35-36-32(8,9)33(10,11)37-35)25-16-23-30(6)20-14-18-28(3)4/h17-18,21,23-24,26,31H,13-16,19-20,22,25H2,1-12H3/b26-24+,29-21+,30-23+/t31-,34-/m1/s1 |
| InChIKey | DPCDQTZJZQIGCV-OIESNNLXSA-N |
| XLogP | 10.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|