C21H37BO2 — CID 52952325
4,4,5,5-tetramethyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1,3,2-dioxaborolane (PubChem CID 52952325) has the molecular formula C21H37BO2 and a molecular weight of 332.34 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 52952325 |
| Molecular Formula | C21H37BO2 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H37BO2/c1-17(2)11-9-12-18(3)13-10-14-19(4)15-16-22-23-20(5,6)21(7,8)24-22/h11,13,15H,9-10,12,14,16H2,1-8H3/b18-13+,19-15+ |
| InChIKey | ZWBZIRGHJGAVNZ-HQSZAHFGSA-N |
| XLogP | 6.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|