C19H35BO2 — CID 59052617
2-[(2R,5E)-6,10-dimethylundeca-5,9-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 59052617) has the molecular formula C19H35BO2 and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-[(2R,5E)-6,10-dimethylundeca-5,9-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2R,5E)-6,10-dimethylundeca-5,9-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 59052617 |
| Molecular Formula | C19H35BO2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 2-[(2R,5E)-6,10-dimethylundeca-5,9-dien-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@H](C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H35BO2/c1-15(2)11-9-12-16(3)13-10-14-17(4)20-21-18(5,6)19(7,8)22-20/h11,13,17H,9-10,12,14H2,1-8H3/b16-13+/t17-/m1/s1 |
| InChIKey | DYIZCXBXSHEIHG-HJUDDPQBSA-N |
| XLogP | 5.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|