C18H33BO2 — CID 164673675
4,4,5,5-tetramethyl-2-[(2E)-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]ethyl]-1,3,2-dioxaborolane (PubChem CID 164673675) has the molecular formula C18H33BO2 and a molecular weight of 292.27 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2E)-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]ethyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2E)-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]ethyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164673675 |
| Molecular Formula | C18H33BO2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2E)-2-[(2S,5R)-5-methyl-2-propan-2-ylcyclohexylidene]ethyl]-1,3,2-dioxaborolane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C/C1=C\CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H33BO2/c1-13(2)16-9-8-14(3)12-15(16)10-11-19-20-17(4,5)18(6,7)21-19/h10,13-14,16H,8-9,11-12H2,1-7H3/b15-10+/t14-,16+/m1/s1 |
| InChIKey | FTLZQEYOHCNXFE-AMKQFNALSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|