C20H26N2O5 — CID 164674368
diethyl 2-[(3E)-3-(benzoylhydrazinylidene)propyl]-2-prop-2-enylpropanedioate (PubChem CID 164674368) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is diethyl 2-[(3E)-3-(benzoylhydrazinylidene)propyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[(3E)-3-(benzoylhydrazinylidene)propyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 164674368 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | diethyl 2-[(3E)-3-(benzoylhydrazinylidene)propyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(CC/C=N/NC(=O)c1ccccc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H26N2O5/c1-4-13-20(18(24)26-5-2,19(25)27-6-3)14-10-15-21-22-17(23)16-11-8-7-9-12-16/h4,7-9,11-12,15H,1,5-6,10,13-14H2,2-3H3,(H,22,23)/b21-15+ |
| InChIKey | AECXXOHSHKXKIZ-RCCKNPSSSA-N |
| XLogP | 2.87 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|