C30H24N2O2 — CID 164674380
1-benzoyl-N,N-dibenzylindole-3-carboxamide (PubChem CID 164674380) has the molecular formula C30H24N2O2 and a molecular weight of 444.53 g/mol. Its IUPAC name is 1-benzoyl-N,N-dibenzylindole-3-carboxamide.
| Compound Name | 1-benzoyl-N,N-dibenzylindole-3-carboxamide |
|---|---|
| PubChem CID | 164674380 |
| Molecular Formula | C30H24N2O2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-benzoyl-N,N-dibenzylindole-3-carboxamide |
| SMILES | O=C(c1cn(C(=O)c2ccccc2)c2ccccc12)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C30H24N2O2/c33-29(25-16-8-3-9-17-25)32-22-27(26-18-10-11-19-28(26)32)30(34)31(20-23-12-4-1-5-13-23)21-24-14-6-2-7-15-24/h1-19,22H,20-21H2 |
| InChIKey | QASDPNFVKLMNGB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |