C19H27N3O5 — CID 164674593
methyl (2S)-2-[[3-acetamido-4-(benzylamino)-4-oxobutanoyl]amino]-3-methylbutanoate (PubChem CID 164674593) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl (2S)-2-[[3-acetamido-4-(benzylamino)-4-oxobutanoyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[3-acetamido-4-(benzylamino)-4-oxobutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 164674593 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | methyl (2S)-2-[[3-acetamido-4-(benzylamino)-4-oxobutanoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)CC(NC(C)=O)C(=O)NCc1ccccc1)C(C)C |
| InChI | InChI=1S/C19H27N3O5/c1-12(2)17(19(26)27-4)22-16(24)10-15(21-13(3)23)18(25)20-11-14-8-6-5-7-9-14/h5-9,12,15,17H,10-11H2,1-4H3,(H,20,25)(H,21,23)(H,22,24)/t15?,17-/m0/s1 |
| InChIKey | FCWHLYNVLNFNFE-LWKPJOBUSA-N |
| XLogP | 0.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |