C21H24F3NOS — CID 164674803
(3S)-N,N-dibenzyl-3-(3,3,3-trifluoropropylsulfanyl)butanamide (PubChem CID 164674803) has the molecular formula C21H24F3NOS and a molecular weight of 395.49 g/mol. Its IUPAC name is (3S)-N,N-dibenzyl-3-(3,3,3-trifluoropropylsulfanyl)butanamide.
| Compound Name | (3S)-N,N-dibenzyl-3-(3,3,3-trifluoropropylsulfanyl)butanamide |
|---|---|
| PubChem CID | 164674803 |
| Molecular Formula | C21H24F3NOS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3S)-N,N-dibenzyl-3-(3,3,3-trifluoropropylsulfanyl)butanamide |
| SMILES | C[C@@H](CC(=O)N(Cc1ccccc1)Cc1ccccc1)SCCC(F)(F)F |
| InChI | InChI=1S/C21H24F3NOS/c1-17(27-13-12-21(22,23)24)14-20(26)25(15-18-8-4-2-5-9-18)16-19-10-6-3-7-11-19/h2-11,17H,12-16H2,1H3/t17-/m0/s1 |
| InChIKey | BLDNJPQVJPRLEM-KRWDZBQOSA-N |
| XLogP | 5.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |