C24H22F3NO3 — CID 164674996
benzyl N-[2-methoxy-2-(4-phenylphenyl)ethyl]-N-(trifluoromethyl)carbamate (PubChem CID 164674996) has the molecular formula C24H22F3NO3 and a molecular weight of 429.44 g/mol. Its IUPAC name is benzyl N-[2-methoxy-2-(4-phenylphenyl)ethyl]-N-(trifluoromethyl)carbamate.
| Compound Name | benzyl N-[2-methoxy-2-(4-phenylphenyl)ethyl]-N-(trifluoromethyl)carbamate |
|---|---|
| PubChem CID | 164674996 |
| Molecular Formula | C24H22F3NO3 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | benzyl N-[2-methoxy-2-(4-phenylphenyl)ethyl]-N-(trifluoromethyl)carbamate |
| SMILES | COC(CN(C(=O)OCc1ccccc1)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22F3NO3/c1-30-22(21-14-12-20(13-15-21)19-10-6-3-7-11-19)16-28(24(25,26)27)23(29)31-17-18-8-4-2-5-9-18/h2-15,22H,16-17H2,1H3 |
| InChIKey | HZVVULGGDKVTAI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|