C28H25F6NO3 — CID 149112154
benzyl (3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate (PubChem CID 149112154) has the molecular formula C28H25F6NO3 and a molecular weight of 537.50 g/mol. Its IUPAC name is benzyl (3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 149112154 |
| Molecular Formula | C28H25F6NO3 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | benzyl (3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate |
| SMILES | C[C@]1(c2ccccc2)CN(C(=O)OCc2ccccc2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H25F6NO3/c1-25(21-10-6-3-7-11-21)18-35(24(36)38-17-19-8-4-2-5-9-19)16-23(25)20-12-14-22(15-13-20)26(37,27(29,30)31)28(32,33)34/h2-15,23,37H,16-18H2,1H3/t23-,25+/m0/s1 |
| InChIKey | QXLWCKRVFWGMJE-UKILVPOCSA-N |
| XLogP | 6.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |