C20H28ClFN2O — CID 164675315
(4R)-N-tert-butyl-8-chloro-4-(4-cyano-3-fluorophenyl)-4-methyloctanamide (PubChem CID 164675315) has the molecular formula C20H28ClFN2O and a molecular weight of 366.91 g/mol. Its IUPAC name is (4R)-N-tert-butyl-8-chloro-4-(4-cyano-3-fluorophenyl)-4-methyloctanamide.
| Compound Name | (4R)-N-tert-butyl-8-chloro-4-(4-cyano-3-fluorophenyl)-4-methyloctanamide |
|---|---|
| PubChem CID | 164675315 |
| Molecular Formula | C20H28ClFN2O |
| Molecular Weight | 366.91 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (4R)-N-tert-butyl-8-chloro-4-(4-cyano-3-fluorophenyl)-4-methyloctanamide |
| SMILES | CC(C)(C)NC(=O)CC[C@@](C)(CCCCCl)c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C20H28ClFN2O/c1-19(2,3)24-18(25)9-11-20(4,10-5-6-12-21)16-8-7-15(14-23)17(22)13-16/h7-8,13H,5-6,9-12H2,1-4H3,(H,24,25)/t20-/m1/s1 |
| InChIKey | FXCPQVWTVPBFAP-HXUWFJFHSA-N |
| XLogP | 5.06 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|